C37H54Br2N4OSi3 — CID 10700609
2-[[2,5-bis[6-bromo-1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 10700609) has the molecular formula C37H54Br2N4OSi3 and a molecular weight of 814.93 g/mol. Its IUPAC name is 2-[[2,5-bis[6-bromo-1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2,5-bis[6-bromo-1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 10700609 |
| Molecular Formula | C37H54Br2N4OSi3 |
| Molecular Weight | 814.93 g/mol |
| Exact Mass | 812.20 |
| IUPAC Name | 2-[[2,5-bis[6-bromo-1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)n1cc(-c2cnc(-c3cn([Si](C)(C)C(C)(C)C)c4cc(Br)ccc34)n2COCC[Si](C)(C)C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C37H54Br2N4OSi3/c1-36(2,3)46(10,11)42-23-30(28-16-14-26(38)20-32(28)42)34-22-40-35(41(34)25-44-18-19-45(7,8)9)31-24-43(47(12,13)37(4,5)6)33-21-27(39)15-17-29(31)33/h14-17,20-24H,18-19,25H2,1-13H3 |
| InChIKey | VPWAZFYGDNKTAD-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 36.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.93 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|