C18H21Br2NSi — CID 140883406
tert-butyl-(2,7-dibromocarbazol-9-yl)-dimethylsilane (PubChem CID 140883406) has the molecular formula C18H21Br2NSi and a molecular weight of 439.27 g/mol. Its IUPAC name is tert-butyl-(2,7-dibromocarbazol-9-yl)-dimethylsilane.
| Compound Name | tert-butyl-(2,7-dibromocarbazol-9-yl)-dimethylsilane |
|---|---|
| PubChem CID | 140883406 |
| Molecular Formula | C18H21Br2NSi |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | tert-butyl-(2,7-dibromocarbazol-9-yl)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)n1c2cc(Br)ccc2c2ccc(Br)cc21 |
| InChI | InChI=1S/C18H21Br2NSi/c1-18(2,3)22(4,5)21-16-10-12(19)6-8-14(16)15-9-7-13(20)11-17(15)21/h6-11H,1-5H3 |
| InChIKey | RTLCEZIZLXZTEJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|