C17H24BrNOSi — CID 101222703
2-[(7-bromo-2,3-dihydro-1H-cyclopenta[b]indol-4-yl)methoxy]ethyl-trimethylsilane (PubChem CID 101222703) has the molecular formula C17H24BrNOSi and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-[(7-bromo-2,3-dihydro-1H-cyclopenta[b]indol-4-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(7-bromo-2,3-dihydro-1H-cyclopenta[b]indol-4-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 101222703 |
| Molecular Formula | C17H24BrNOSi |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2-[(7-bromo-2,3-dihydro-1H-cyclopenta[b]indol-4-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c2c(c3cc(Br)ccc31)CCC2 |
| InChI | InChI=1S/C17H24BrNOSi/c1-21(2,3)10-9-20-12-19-16-6-4-5-14(16)15-11-13(18)7-8-17(15)19/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | MKMGVTNHUADYQK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|