C28H30Br2N4O2Si — CID 10919320
[4-bromo-3-[5-(6-bromo-1H-indol-3-yl)-6-methoxypyrazin-2-yl]-7-methoxyindol-1-yl]-tert-butyl-dimethylsilane (PubChem CID 10919320) has the molecular formula C28H30Br2N4O2Si and a molecular weight of 642.47 g/mol. Its IUPAC name is [4-bromo-3-[5-(6-bromo-1H-indol-3-yl)-6-methoxypyrazin-2-yl]-7-methoxyindol-1-yl]-tert-butyl-dimethylsilane.
| Compound Name | [4-bromo-3-[5-(6-bromo-1H-indol-3-yl)-6-methoxypyrazin-2-yl]-7-methoxyindol-1-yl]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10919320 |
| Molecular Formula | C28H30Br2N4O2Si |
| Molecular Weight | 642.47 g/mol |
| Exact Mass | 640.05 |
| IUPAC Name | [4-bromo-3-[5-(6-bromo-1H-indol-3-yl)-6-methoxypyrazin-2-yl]-7-methoxyindol-1-yl]-tert-butyl-dimethylsilane |
| SMILES | COc1nc(-c2cn([Si](C)(C)C(C)(C)C)c3c(OC)ccc(Br)c23)cnc1-c1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C28H30Br2N4O2Si/c1-28(2,3)37(6,7)34-15-19(24-20(30)10-11-23(35-4)26(24)34)22-14-32-25(27(33-22)36-5)18-13-31-21-12-16(29)8-9-17(18)21/h8-15,31H,1-7H3 |
| InChIKey | XRTFTEHAOJKLDS-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.47 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|