C23H21BrN7S+ — CID 132577693
2-[3-(6-bromo-1H-indol-3-yl)-6-(1H-indol-3-yl)pyrazin-2-yl]sulfanylethyl-(diaminomethylidene)azanium (PubChem CID 132577693) has the molecular formula C23H21BrN7S+ and a molecular weight of 507.44 g/mol. Its IUPAC name is 2-[3-(6-bromo-1H-indol-3-yl)-6-(1H-indol-3-yl)pyrazin-2-yl]sulfanylethyl-(diaminomethylidene)azanium.
| Compound Name | 2-[3-(6-bromo-1H-indol-3-yl)-6-(1H-indol-3-yl)pyrazin-2-yl]sulfanylethyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 132577693 |
| Molecular Formula | C23H21BrN7S+ |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-[3-(6-bromo-1H-indol-3-yl)-6-(1H-indol-3-yl)pyrazin-2-yl]sulfanylethyl-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]CCSc1nc(-c2c[nH]c3ccccc23)cnc1-c1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C23H20BrN7S/c24-13-5-6-15-17(11-29-19(15)9-13)21-22(32-8-7-27-23(25)26)31-20(12-30-21)16-10-28-18-4-2-1-3-14(16)18/h1-6,9-12,28-29H,7-8H2,(H4,25,26,27)/p+1 |
| InChIKey | OQPNDNGMADLNIP-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|