C28H21N3 — CID 139242602
3-[5,6-bis[(E)-2-phenylethenyl]pyrazin-2-yl]-1H-indole (PubChem CID 139242602) has the molecular formula C28H21N3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-[5,6-bis[(E)-2-phenylethenyl]pyrazin-2-yl]-1H-indole.
| Compound Name | 3-[5,6-bis[(E)-2-phenylethenyl]pyrazin-2-yl]-1H-indole |
|---|---|
| PubChem CID | 139242602 |
| Molecular Formula | C28H21N3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[5,6-bis[(E)-2-phenylethenyl]pyrazin-2-yl]-1H-indole |
| SMILES | C(=C/c1ncc(-c2c[nH]c3ccccc23)nc1/C=C/c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C28H21N3/c1-3-9-21(10-4-1)15-17-26-27(18-16-22-11-5-2-6-12-22)31-28(20-30-26)24-19-29-25-14-8-7-13-23(24)25/h1-20,29H/b17-15+,18-16+ |
| InChIKey | QVBAHOQZEGQLCW-YTEMWHBBSA-N |
| XLogP | 6.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |