C17H20N6 — CID 172991348
2-[3-[6-(1H-indol-3-yl)-3-methylpyrazin-2-yl]propyl]guanidine (PubChem CID 172991348) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-[3-[6-(1H-indol-3-yl)-3-methylpyrazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[6-(1H-indol-3-yl)-3-methylpyrazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 172991348 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[3-[6-(1H-indol-3-yl)-3-methylpyrazin-2-yl]propyl]guanidine |
| SMILES | Cc1ncc(-c2c[nH]c3ccccc23)nc1CCCN=C(N)N |
| InChI | InChI=1S/C17H20N6/c1-11-14(7-4-8-20-17(18)19)23-16(10-21-11)13-9-22-15-6-3-2-5-12(13)15/h2-3,5-6,9-10,22H,4,7-8H2,1H3,(H4,18,19,20) |
| InChIKey | POCYHWYAZVRGHV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|