C21H25N7O — CID 136823497
2-[3-[3-hydroxy-6-(1H-indol-3-yl)-2-propan-2-ylimidazo[1,2-a]pyrazin-8-yl]propyl]guanidine (PubChem CID 136823497) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-[3-[3-hydroxy-6-(1H-indol-3-yl)-2-propan-2-ylimidazo[1,2-a]pyrazin-8-yl]propyl]guanidine.
| Compound Name | 2-[3-[3-hydroxy-6-(1H-indol-3-yl)-2-propan-2-ylimidazo[1,2-a]pyrazin-8-yl]propyl]guanidine |
|---|---|
| PubChem CID | 136823497 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-[3-[3-hydroxy-6-(1H-indol-3-yl)-2-propan-2-ylimidazo[1,2-a]pyrazin-8-yl]propyl]guanidine |
| SMILES | CC(C)c1nc2c(CCCN=C(N)N)nc(-c3c[nH]c4ccccc34)cn2c1O |
| InChI | InChI=1S/C21H25N7O/c1-12(2)18-20(29)28-11-17(14-10-25-15-7-4-3-6-13(14)15)26-16(19(28)27-18)8-5-9-24-21(22)23/h3-4,6-7,10-12,25,29H,5,8-9H2,1-2H3,(H4,22,23,24) |
| InChIKey | VHHALVIQHXCKMR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|