C21H17N3O2 — CID 91429863
3,4-bis(1H-indol-3-yl)-1-methylpyrrole-2,5-diol (PubChem CID 91429863) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 3,4-bis(1H-indol-3-yl)-1-methylpyrrole-2,5-diol.
| Compound Name | 3,4-bis(1H-indol-3-yl)-1-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91429863 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3,4-bis(1H-indol-3-yl)-1-methylpyrrole-2,5-diol |
| SMILES | Cn1c(O)c(-c2c[nH]c3ccccc23)c(-c2c[nH]c3ccccc23)c1O |
| InChI | InChI=1S/C21H17N3O2/c1-24-20(25)18(14-10-22-16-8-4-2-6-12(14)16)19(21(24)26)15-11-23-17-9-5-3-7-13(15)17/h2-11,22-23,25-26H,1H3 |
| InChIKey | RPWBCJWJUPEJSQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |