C16H29N3OSiSn — CID 172600662
trimethyl-[2-[(4-methyl-5-trimethylstannylpyrazolo[3,4-c]pyridin-2-yl)methoxy]ethyl]silane (PubChem CID 172600662) has the molecular formula C16H29N3OSiSn and a molecular weight of 426.23 g/mol. Its IUPAC name is trimethyl-[2-[(4-methyl-5-trimethylstannylpyrazolo[3,4-c]pyridin-2-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(4-methyl-5-trimethylstannylpyrazolo[3,4-c]pyridin-2-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 172600662 |
| Molecular Formula | C16H29N3OSiSn |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | trimethyl-[2-[(4-methyl-5-trimethylstannylpyrazolo[3,4-c]pyridin-2-yl)methoxy]ethyl]silane |
| SMILES | Cc1c([Sn](C)(C)C)ncc2nn(COCC[Si](C)(C)C)cc12 |
| InChI | InChI=1S/C13H20N3OSi.3CH3.Sn/c1-11-7-14-8-13-12(11)9-16(15-13)10-17-5-6-18(2,3)4;;;;/h8-9H,5-6,10H2,1-4H3;3*1H3; |
| InChIKey | LIAARFPCUGQBIX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|