C28H32N6O3SSi — CID 172600324
N-(4-methylsulfonylphenyl)-5-[4-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]-2,6-naphthyridin-3-amine (PubChem CID 172600324) has the molecular formula C28H32N6O3SSi and a molecular weight of 560.76 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-5-[4-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]-2,6-naphthyridin-3-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-5-[4-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172600324 |
| Molecular Formula | C28H32N6O3SSi |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-5-[4-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]-2,6-naphthyridin-3-amine |
| SMILES | Cc1c(-c2nccc3cnc(Nc4ccc(S(C)(=O)=O)cc4)cc23)ncc2nn(COCC[Si](C)(C)C)cc12 |
| InChI | InChI=1S/C28H32N6O3SSi/c1-19-24-17-34(18-37-12-13-39(3,4)5)33-25(24)16-31-27(19)28-23-14-26(30-15-20(23)10-11-29-28)32-21-6-8-22(9-7-21)38(2,35)36/h6-11,14-17H,12-13,18H2,1-5H3,(H,30,32) |
| InChIKey | OVXHVZQULPMJGO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|