C15H12IN3O2S — CID 172600310
5-iodo-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine (PubChem CID 172600310) has the molecular formula C15H12IN3O2S and a molecular weight of 425.25 g/mol. Its IUPAC name is 5-iodo-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine.
| Compound Name | 5-iodo-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172600310 |
| Molecular Formula | C15H12IN3O2S |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | 5-iodo-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2cc3c(I)nccc3cn2)cc1 |
| InChI | InChI=1S/C15H12IN3O2S/c1-22(20,21)12-4-2-11(3-5-12)19-14-8-13-10(9-18-14)6-7-17-15(13)16/h2-9H,1H3,(H,18,19) |
| InChIKey | CIEWPRLWEMVYPV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|