C23H18N4O3S — CID 172600118
5-[2-(2-methoxy-4-pyridinyl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine (PubChem CID 172600118) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is 5-[2-(2-methoxy-4-pyridinyl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine.
| Compound Name | 5-[2-(2-methoxy-4-pyridinyl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172600118 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 5-[2-(2-methoxy-4-pyridinyl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
| SMILES | COc1cc(C#Cc2nccc3cnc(Nc4ccc(S(C)(=O)=O)cc4)cc23)ccn1 |
| InChI | InChI=1S/C23H18N4O3S/c1-30-23-13-16(9-11-25-23)3-8-21-20-14-22(26-15-17(20)10-12-24-21)27-18-4-6-19(7-5-18)31(2,28)29/h4-7,9-15H,1-2H3,(H,26,27) |
| InChIKey | OXPSEZFFDXXJJL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|