C22H16F3N5O2S — CID 172600851
N-(4-methylsulfonylphenyl)-5-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethynyl]-2,6-naphthyridin-3-amine (PubChem CID 172600851) has the molecular formula C22H16F3N5O2S and a molecular weight of 471.46 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-5-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethynyl]-2,6-naphthyridin-3-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-5-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethynyl]-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172600851 |
| Molecular Formula | C22H16F3N5O2S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-5-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethynyl]-2,6-naphthyridin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2cc3c(C#Cc4cnn(CC(F)(F)F)c4)nccc3cn2)cc1 |
| InChI | InChI=1S/C22H16F3N5O2S/c1-33(31,32)18-5-3-17(4-6-18)29-21-10-19-16(12-27-21)8-9-26-20(19)7-2-15-11-28-30(13-15)14-22(23,24)25/h3-6,8-13H,14H2,1H3,(H,27,29) |
| InChIKey | GSLGLYXGGINIOC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|