C21H15ClN6O2S — CID 172600972
5-[2-(5-amino-3-chloropyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine (PubChem CID 172600972) has the molecular formula C21H15ClN6O2S and a molecular weight of 450.91 g/mol. Its IUPAC name is 5-[2-(5-amino-3-chloropyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine.
| Compound Name | 5-[2-(5-amino-3-chloropyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172600972 |
| Molecular Formula | C21H15ClN6O2S |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 5-[2-(5-amino-3-chloropyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2cc3c(C#Cc4ncc(N)nc4Cl)nccc3cn2)cc1 |
| InChI | InChI=1S/C21H15ClN6O2S/c1-31(29,30)15-4-2-14(3-5-15)27-20-10-16-13(11-26-20)8-9-24-17(16)6-7-18-21(22)28-19(23)12-25-18/h2-5,8-12H,1H3,(H2,23,28)(H,26,27) |
| InChIKey | DTXQQWAFROQFRA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|