C24H22N6S — CID 172601108
5-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-(propan-2-ylamino)sulfanylphenyl]-2,6-naphthyridin-3-amine (PubChem CID 172601108) has the molecular formula C24H22N6S and a molecular weight of 426.55 g/mol. Its IUPAC name is 5-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-(propan-2-ylamino)sulfanylphenyl]-2,6-naphthyridin-3-amine.
| Compound Name | 5-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-(propan-2-ylamino)sulfanylphenyl]-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172601108 |
| Molecular Formula | C24H22N6S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-[2-(2-amino-3-pyridinyl)ethynyl]-N-[4-(propan-2-ylamino)sulfanylphenyl]-2,6-naphthyridin-3-amine |
| SMILES | CC(C)NSc1ccc(Nc2cc3c(C#Cc4cccnc4N)nccc3cn2)cc1 |
| InChI | InChI=1S/C24H22N6S/c1-16(2)30-31-20-8-6-19(7-9-20)29-23-14-21-18(15-28-23)11-13-26-22(21)10-5-17-4-3-12-27-24(17)25/h3-4,6-9,11-16,30H,1-2H3,(H2,25,27)(H,28,29) |
| InChIKey | HIZAWFRSCJKZGK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|