C29H26N4OS — CID 172601226
3,3-diethyl-6-[2-[7-(4-methylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-1H-indol-2-one (PubChem CID 172601226) has the molecular formula C29H26N4OS and a molecular weight of 478.62 g/mol. Its IUPAC name is 3,3-diethyl-6-[2-[7-(4-methylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-1H-indol-2-one.
| Compound Name | 3,3-diethyl-6-[2-[7-(4-methylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 172601226 |
| Molecular Formula | C29H26N4OS |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3,3-diethyl-6-[2-[7-(4-methylsulfanylanilino)-2,6-naphthyridin-1-yl]ethynyl]-1H-indol-2-one |
| SMILES | CCC1(CC)C(=O)Nc2cc(C#Cc3nccc4cnc(Nc5ccc(SC)cc5)cc34)ccc21 |
| InChI | InChI=1S/C29H26N4OS/c1-4-29(5-2)24-12-6-19(16-26(24)33-28(29)34)7-13-25-23-17-27(31-18-20(23)14-15-30-25)32-21-8-10-22(35-3)11-9-21/h6,8-12,14-18H,4-5H2,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | WDNNGZDAYXRIJD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|