C30H27N5OS — CID 172600047
6-[2-[7-[4-(cyclobutylamino)sulfanylanilino]-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one (PubChem CID 172600047) has the molecular formula C30H27N5OS and a molecular weight of 505.65 g/mol. Its IUPAC name is 6-[2-[7-[4-(cyclobutylamino)sulfanylanilino]-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 6-[2-[7-[4-(cyclobutylamino)sulfanylanilino]-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 172600047 |
| Molecular Formula | C30H27N5OS |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 6-[2-[7-[4-(cyclobutylamino)sulfanylanilino]-2,6-naphthyridin-1-yl]ethynyl]-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2cc(C#Cc3nccc4cnc(Nc5ccc(SNC6CCC6)cc5)cc34)ccc21 |
| InChI | InChI=1S/C30H27N5OS/c1-30(2)25-12-6-19(16-27(25)34-29(30)36)7-13-26-24-17-28(32-18-20(24)14-15-31-26)33-21-8-10-23(11-9-21)37-35-22-4-3-5-22/h6,8-12,14-18,22,35H,3-5H2,1-2H3,(H,32,33)(H,34,36) |
| InChIKey | KJFNRLMRBAJMFD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|