C23H19N5O2S — CID 172600763
5-[2-(3,5-dimethylpyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine (PubChem CID 172600763) has the molecular formula C23H19N5O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is 5-[2-(3,5-dimethylpyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine.
| Compound Name | 5-[2-(3,5-dimethylpyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172600763 |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5-[2-(3,5-dimethylpyrazin-2-yl)ethynyl]-N-(4-methylsulfonylphenyl)-2,6-naphthyridin-3-amine |
| SMILES | Cc1cnc(C#Cc2nccc3cnc(Nc4ccc(S(C)(=O)=O)cc4)cc23)c(C)n1 |
| InChI | InChI=1S/C23H19N5O2S/c1-15-13-25-21(16(2)27-15)8-9-22-20-12-23(26-14-17(20)10-11-24-22)28-18-4-6-19(7-5-18)31(3,29)30/h4-7,10-14H,1-3H3,(H,26,28) |
| InChIKey | QCRHDKVZGJLYID-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|