C21H23N3O3S — CID 172600044
cis-(1S,3R)-3-[7-(4-methylsulfonylanilino)-2,6-naphthyridin-1-yl]cyclohexan-1-ol (PubChem CID 172600044) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is cis-(1S,3R)-3-[7-(4-methylsulfonylanilino)-2,6-naphthyridin-1-yl]cyclohexan-1-ol.
| Compound Name | cis-(1S,3R)-3-[7-(4-methylsulfonylanilino)-2,6-naphthyridin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 172600044 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | cis-(1S,3R)-3-[7-(4-methylsulfonylanilino)-2,6-naphthyridin-1-yl]cyclohexan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(Nc2cc3c([C@@H]4CCC[C@H](O)C4)nccc3cn2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-28(26,27)18-7-5-16(6-8-18)24-20-12-19-15(13-23-20)9-10-22-21(19)14-3-2-4-17(25)11-14/h5-10,12-14,17,25H,2-4,11H2,1H3,(H,23,24)/t14-,17+/m1/s1 |
| InChIKey | ZTDZDDIBAPRNBI-PBHICJAKSA-N |
| XLogP | 3.80 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |