About ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate
ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 166028164) has the molecular formula C12H21N5O3Si
and a molecular weight of 311.42 g/mol. Its IUPAC name is ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate |
| PubChem CID | 166028164 |
| Molecular Formula | C12H21N5O3Si |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | CCOC(=O)C(=[N+]=[N-])c1ncn(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C12H21N5O3Si/c1-5-20-12(18)10(15-13)11-14-8-17(16-11)9-19-6-7-21(2,3)4/h8H,5-7,9H2,1-4H3 |
| InChIKey | ZAZVGNWCYVLLEV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate?
The IUPAC name of ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate (CID 166028164) is ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate.
What is the SMILES notation for ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate?
The canonical SMILES for ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate is CCOC(=O)C(=[N+]=[N-])c1ncn(COCC[Si](C)(C)C)n1.
What is the InChIKey of ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate?
The InChIKey is ZAZVGNWCYVLLEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O3Si/c1-5-20-12(18)10(15-13)11-14-8-17(16-11)9-19-6-7-21(2,3)4/h8H,5-7,9H2,1-4H3.
What are the key properties of ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate?
ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate has a molecular weight of 311.42 g/mol, XLogP of 1.17, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate is sourced from PubChem (CID 166028164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).