C12H21N5O3Si — CID 166028164
ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 166028164) has the molecular formula C12H21N5O3Si and a molecular weight of 311.42 g/mol. Its IUPAC name is ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate.
| Compound Name | ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 166028164 |
| Molecular Formula | C12H21N5O3Si |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | ethyl 2-diazo-2-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | CCOC(=O)C(=[N+]=[N-])c1ncn(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C12H21N5O3Si/c1-5-20-12(18)10(15-13)11-14-8-17(16-11)9-19-6-7-21(2,3)4/h8H,5-7,9H2,1-4H3 |
| InChIKey | ZAZVGNWCYVLLEV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|