C13H22N2O5Si — CID 140713204
ethyl 5-hydroxy-4-oxo-1-(2-trimethylsilylethoxymethyl)pyridazine-3-carboxylate (PubChem CID 140713204) has the molecular formula C13H22N2O5Si and a molecular weight of 314.41 g/mol. Its IUPAC name is ethyl 5-hydroxy-4-oxo-1-(2-trimethylsilylethoxymethyl)pyridazine-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-4-oxo-1-(2-trimethylsilylethoxymethyl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 140713204 |
| Molecular Formula | C13H22N2O5Si |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethyl 5-hydroxy-4-oxo-1-(2-trimethylsilylethoxymethyl)pyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(COCC[Si](C)(C)C)cc(O)c1=O |
| InChI | InChI=1S/C13H22N2O5Si/c1-5-20-13(18)11-12(17)10(16)8-15(14-11)9-19-6-7-21(2,3)4/h8,16H,5-7,9H2,1-4H3 |
| InChIKey | GXRDYIQIMHLXQV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|