C19H24ClN3O3Si — CID 156678789
ethyl 5-[2-(4-chlorophenyl)ethynyl]-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate (PubChem CID 156678789) has the molecular formula C19H24ClN3O3Si and a molecular weight of 405.96 g/mol. Its IUPAC name is ethyl 5-[2-(4-chlorophenyl)ethynyl]-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-[2-(4-chlorophenyl)ethynyl]-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 156678789 |
| Molecular Formula | C19H24ClN3O3Si |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | ethyl 5-[2-(4-chlorophenyl)ethynyl]-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nn(COCC[Si](C)(C)C)nc1C#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O3Si/c1-5-26-19(24)18-17(11-8-15-6-9-16(20)10-7-15)21-23(22-18)14-25-12-13-27(2,3)4/h6-7,9-10H,5,12-14H2,1-4H3 |
| InChIKey | VOACOSIHSFEQHO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|