C14H22N2O6Si — CID 177253844
2-[2-ethoxycarbonyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoacetic acid (PubChem CID 177253844) has the molecular formula C14H22N2O6Si and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[2-ethoxycarbonyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-ethoxycarbonyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 177253844 |
| Molecular Formula | C14H22N2O6Si |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[2-ethoxycarbonyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoacetic acid |
| SMILES | CCOC(=O)c1ncc(C(=O)C(=O)O)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H22N2O6Si/c1-5-22-14(20)12-15-8-10(11(17)13(18)19)16(12)9-21-6-7-23(2,3)4/h8H,5-7,9H2,1-4H3,(H,18,19) |
| InChIKey | KBSDDJXQLOHIHX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|