C11H20N2O3Si — CID 166022930
2-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylic acid (PubChem CID 166022930) has the molecular formula C11H20N2O3Si and a molecular weight of 256.38 g/mol. Its IUPAC name is 2-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylic acid.
| Compound Name | 2-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166022930 |
| Molecular Formula | C11H20N2O3Si |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-methyl-3-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylic acid |
| SMILES | Cc1ncc(C(=O)O)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C11H20N2O3Si/c1-9-12-7-10(11(14)15)13(9)8-16-5-6-17(2,3)4/h7H,5-6,8H2,1-4H3,(H,14,15) |
| InChIKey | KDVSFWWMMQBFLT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|