C18H27N3O4SSi — CID 168792695
methyl 4-[[2-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]sulfonimidoyl]benzoate (PubChem CID 168792695) has the molecular formula C18H27N3O4SSi and a molecular weight of 409.58 g/mol. Its IUPAC name is methyl 4-[[2-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]sulfonimidoyl]benzoate.
| Compound Name | methyl 4-[[2-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]sulfonimidoyl]benzoate |
|---|---|
| PubChem CID | 168792695 |
| Molecular Formula | C18H27N3O4SSi |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 4-[[2-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]sulfonimidoyl]benzoate |
| SMILES | [H]N=S(=O)(c1ccc(C(=O)OC)cc1)c1cnc(C)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H27N3O4SSi/c1-14-20-12-17(21(14)13-25-10-11-27(3,4)5)26(19,23)16-8-6-15(7-9-16)18(22)24-2/h6-9,12,19H,10-11,13H2,1-5H3 |
| InChIKey | AEPKPEHLQKKBJJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|