C23H27ClFN3O3Si — CID 176706576
methyl 4-[5-chloro-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylbenzoate (PubChem CID 176706576) has the molecular formula C23H27ClFN3O3Si and a molecular weight of 476.02 g/mol. Its IUPAC name is methyl 4-[5-chloro-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[5-chloro-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 176706576 |
| Molecular Formula | C23H27ClFN3O3Si |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | methyl 4-[5-chloro-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(-c2c(Cl)nc(-c3ccc(F)cn3)n2COCC[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C23H27ClFN3O3Si/c1-15-12-16(23(29)30-2)6-8-18(15)20-21(24)27-22(19-9-7-17(25)13-26-19)28(20)14-31-10-11-32(3,4)5/h6-9,12-13H,10-11,14H2,1-5H3 |
| InChIKey | MUZKTVGKGFRKDZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|