C27H43FN4O3Si — CID 176706679
tert-butyl 4-[5-ethyl-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylpiperidine-1-carboxylate (PubChem CID 176706679) has the molecular formula C27H43FN4O3Si and a molecular weight of 518.75 g/mol. Its IUPAC name is tert-butyl 4-[5-ethyl-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-ethyl-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 176706679 |
| Molecular Formula | C27H43FN4O3Si |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | tert-butyl 4-[5-ethyl-2-(5-fluoro-2-pyridinyl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-methylpiperidine-1-carboxylate |
| SMILES | CCc1nc(-c2ccc(F)cn2)n(COCC[Si](C)(C)C)c1C1CCN(C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C27H43FN4O3Si/c1-9-22-24(21-12-13-31(17-19(21)2)26(33)35-27(3,4)5)32(18-34-14-15-36(6,7)8)25(30-22)23-11-10-20(28)16-29-23/h10-11,16,19,21H,9,12-15,17-18H2,1-8H3 |
| InChIKey | CEGDCBKSFMGXAM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|