C20H26FNO3 — CID 22495649
tert-butyl 4-(5-fluoro-2-methyl-1-benzofuran-7-yl)-3-methylpiperidine-1-carboxylate (PubChem CID 22495649) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is tert-butyl 4-(5-fluoro-2-methyl-1-benzofuran-7-yl)-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-fluoro-2-methyl-1-benzofuran-7-yl)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 22495649 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl 4-(5-fluoro-2-methyl-1-benzofuran-7-yl)-3-methylpiperidine-1-carboxylate |
| SMILES | Cc1cc2cc(F)cc(C3CCN(C(=O)OC(C)(C)C)CC3C)c2o1 |
| InChI | InChI=1S/C20H26FNO3/c1-12-11-22(19(23)25-20(3,4)5)7-6-16(12)17-10-15(21)9-14-8-13(2)24-18(14)17/h8-10,12,16H,6-7,11H2,1-5H3 |
| InChIKey | CWYHBTOREGPEHW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |