C18H26BrNO2 — CID 172993588
tert-butyl 4-(3-bromo-5-methylphenyl)-3-methylpiperidine-1-carboxylate (PubChem CID 172993588) has the molecular formula C18H26BrNO2 and a molecular weight of 368.32 g/mol. Its IUPAC name is tert-butyl 4-(3-bromo-5-methylphenyl)-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-bromo-5-methylphenyl)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 172993588 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | tert-butyl 4-(3-bromo-5-methylphenyl)-3-methylpiperidine-1-carboxylate |
| SMILES | Cc1cc(Br)cc(C2CCN(C(=O)OC(C)(C)C)CC2C)c1 |
| InChI | InChI=1S/C18H26BrNO2/c1-12-8-14(10-15(19)9-12)16-6-7-20(11-13(16)2)17(21)22-18(3,4)5/h8-10,13,16H,6-7,11H2,1-5H3 |
| InChIKey | BTDRRDVPHWOIST-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |