C14H18BrNO2 — CID 118143642
methyl 4-(4-bromophenyl)-3-methylpiperidine-1-carboxylate (PubChem CID 118143642) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-3-methylpiperidine-1-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118143642 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | methyl 4-(4-bromophenyl)-3-methylpiperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2ccc(Br)cc2)C(C)C1 |
| InChI | InChI=1S/C14H18BrNO2/c1-10-9-16(14(17)18-2)8-7-13(10)11-3-5-12(15)6-4-11/h3-6,10,13H,7-9H2,1-2H3 |
| InChIKey | AJBVCZPEJKWMHB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |