C24H30BrN3O4 — CID 139466484
tert-butyl 4-[(4-bromophenyl)carbamoylamino]-3-(4-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 139466484) has the molecular formula C24H30BrN3O4 and a molecular weight of 504.43 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromophenyl)carbamoylamino]-3-(4-methoxyphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromophenyl)carbamoylamino]-3-(4-methoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139466484 |
| Molecular Formula | C24H30BrN3O4 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | tert-butyl 4-[(4-bromophenyl)carbamoylamino]-3-(4-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | COc1ccc(C2CN(C(=O)OC(C)(C)C)CCC2NC(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H30BrN3O4/c1-24(2,3)32-23(30)28-14-13-21(20(15-28)16-5-11-19(31-4)12-6-16)27-22(29)26-18-9-7-17(25)8-10-18/h5-12,20-21H,13-15H2,1-4H3,(H2,26,27,29) |
| InChIKey | SDGDZQUOSYXFEK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |