C20H22BrN3O3 — CID 139475898
1-(4-bromophenyl)-3-[(4S)-5-(4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea (PubChem CID 139475898) has the molecular formula C20H22BrN3O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(4S)-5-(4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[(4S)-5-(4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea |
|---|---|
| PubChem CID | 139475898 |
| Molecular Formula | C20H22BrN3O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(4S)-5-(4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea |
| SMILES | COc1ccc(C2CN(C)C(=O)C[C@@H]2NC(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H22BrN3O3/c1-24-12-17(13-3-9-16(27-2)10-4-13)18(11-19(24)25)23-20(26)22-15-7-5-14(21)6-8-15/h3-10,17-18H,11-12H2,1-2H3,(H2,22,23,26)/t17?,18-/m0/s1 |
| InChIKey | PCDFANMMHOIDLC-ZVAWYAOSSA-N |
| XLogP | 3.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |