C26H26ClN3O4 — CID 139475787
1-[(4R)-1,5-bis(4-methoxyphenyl)-2-oxopiperidin-4-yl]-3-(4-chlorophenyl)urea (PubChem CID 139475787) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is 1-[(4R)-1,5-bis(4-methoxyphenyl)-2-oxopiperidin-4-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(4R)-1,5-bis(4-methoxyphenyl)-2-oxopiperidin-4-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 139475787 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1-[(4R)-1,5-bis(4-methoxyphenyl)-2-oxopiperidin-4-yl]-3-(4-chlorophenyl)urea |
| SMILES | COc1ccc(C2CN(c3ccc(OC)cc3)C(=O)C[C@H]2NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H26ClN3O4/c1-33-21-11-3-17(4-12-21)23-16-30(20-9-13-22(34-2)14-10-20)25(31)15-24(23)29-26(32)28-19-7-5-18(27)6-8-19/h3-14,23-24H,15-16H2,1-2H3,(H2,28,29,32)/t23?,24-/m1/s1 |
| InChIKey | STZQZZJQNXKWES-XMMISQBUSA-N |
| XLogP | 5.07 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |