C20H21ClFN3O3 — CID 139475778
1-(4-chlorophenyl)-3-[5-(2-fluoro-4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea (PubChem CID 139475778) has the molecular formula C20H21ClFN3O3 and a molecular weight of 405.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[5-(2-fluoro-4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[5-(2-fluoro-4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea |
|---|---|
| PubChem CID | 139475778 |
| Molecular Formula | C20H21ClFN3O3 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[5-(2-fluoro-4-methoxyphenyl)-1-methyl-2-oxopiperidin-4-yl]urea |
| SMILES | COc1ccc(C2CN(C)C(=O)CC2NC(=O)Nc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C20H21ClFN3O3/c1-25-11-16(15-8-7-14(28-2)9-17(15)22)18(10-19(25)26)24-20(27)23-13-5-3-12(21)4-6-13/h3-9,16,18H,10-11H2,1-2H3,(H2,23,24,27) |
| InChIKey | VNFFJBSOXGBLDS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |