C19H20ClF2N3O2 — CID 134347569
1-(4-chlorophenyl)-3-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)piperidin-3-yl]urea (PubChem CID 134347569) has the molecular formula C19H20ClF2N3O2 and a molecular weight of 395.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)piperidin-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 134347569 |
| Molecular Formula | C19H20ClF2N3O2 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)piperidin-3-yl]urea |
| SMILES | COc1cc(F)c([C@@H]2CCNC[C@H]2NC(=O)Nc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C19H20ClF2N3O2/c1-27-13-8-15(21)18(16(22)9-13)14-6-7-23-10-17(14)25-19(26)24-12-4-2-11(20)3-5-12/h2-5,8-9,14,17,23H,6-7,10H2,1H3,(H2,24,25,26)/t14-,17-/m1/s1 |
| InChIKey | UVZAWAKNPMZNND-RHSMWYFYSA-N |
| XLogP | 3.89 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |