C19H19ClFN3O3 — CID 134361253
1-(4-chlorophenyl)-3-[(3S)-4-(2-fluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]urea (PubChem CID 134361253) has the molecular formula C19H19ClFN3O3 and a molecular weight of 391.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3S)-4-(2-fluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3S)-4-(2-fluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 134361253 |
| Molecular Formula | C19H19ClFN3O3 |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3S)-4-(2-fluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]urea |
| SMILES | COc1ccc(C2CC(=O)NC[C@H]2NC(=O)Nc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C19H19ClFN3O3/c1-27-13-6-7-14(16(21)8-13)15-9-18(25)22-10-17(15)24-19(26)23-12-4-2-11(20)3-5-12/h2-8,15,17H,9-10H2,1H3,(H,22,25)(H2,23,24,26)/t15?,17-/m1/s1 |
| InChIKey | XBAKLTWMOBXZLQ-OMOCHNIRSA-N |
| XLogP | 3.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |