C18H19ClF2N4O2 — CID 139466700
1-(5-chloro-2-pyridinyl)-3-[3-(2,6-difluoro-4-methoxyphenyl)piperidin-4-yl]urea (PubChem CID 139466700) has the molecular formula C18H19ClF2N4O2 and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-3-[3-(2,6-difluoro-4-methoxyphenyl)piperidin-4-yl]urea.
| Compound Name | 1-(5-chloro-2-pyridinyl)-3-[3-(2,6-difluoro-4-methoxyphenyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 139466700 |
| Molecular Formula | C18H19ClF2N4O2 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-3-[3-(2,6-difluoro-4-methoxyphenyl)piperidin-4-yl]urea |
| SMILES | COc1cc(F)c(C2CNCCC2NC(=O)Nc2ccc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C18H19ClF2N4O2/c1-27-11-6-13(20)17(14(21)7-11)12-9-22-5-4-15(12)24-18(26)25-16-3-2-10(19)8-23-16/h2-3,6-8,12,15,22H,4-5,9H2,1H3,(H2,23,24,25,26) |
| InChIKey | BQXNFCPEZVVBIA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |