C17H15ClF2N4O3 — CID 122583030
1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea (PubChem CID 122583030) has the molecular formula C17H15ClF2N4O3 and a molecular weight of 396.78 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 122583030 |
| Molecular Formula | C17H15ClF2N4O3 |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-3-yl]urea |
| SMILES | COc1cc(F)c(C2CNC(=O)C2NC(=O)Nc2ccc(Cl)nc2)c(F)c1 |
| InChI | InChI=1S/C17H15ClF2N4O3/c1-27-9-4-11(19)14(12(20)5-9)10-7-22-16(25)15(10)24-17(26)23-8-2-3-13(18)21-6-8/h2-6,10,15H,7H2,1H3,(H,22,25)(H2,23,24,26) |
| InChIKey | QOCJLXPBOOFYMQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|