C19H19ClF2N4O4 — CID 122583015
1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]urea (PubChem CID 122583015) has the molecular formula C19H19ClF2N4O4 and a molecular weight of 440.83 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 122583015 |
| Molecular Formula | C19H19ClF2N4O4 |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-3-[4-(2,6-difluoro-4-methoxyphenyl)-1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]urea |
| SMILES | COc1cc(F)c(C2CN(CCO)C(=O)C2NC(=O)Nc2ccc(Cl)nc2)c(F)c1 |
| InChI | InChI=1S/C19H19ClF2N4O4/c1-30-11-6-13(21)16(14(22)7-11)12-9-26(4-5-27)18(28)17(12)25-19(29)24-10-2-3-15(20)23-8-10/h2-3,6-8,12,17,27H,4-5,9H2,1H3,(H2,24,25,29) |
| InChIKey | POCSPVLYSJGJSI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|