C26H28ClN3O3 — CID 139466768
1-[(3R,4R)-1,3-bis(4-methoxyphenyl)piperidin-4-yl]-3-(4-chlorophenyl)urea (PubChem CID 139466768) has the molecular formula C26H28ClN3O3 and a molecular weight of 465.98 g/mol. Its IUPAC name is 1-[(3R,4R)-1,3-bis(4-methoxyphenyl)piperidin-4-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[(3R,4R)-1,3-bis(4-methoxyphenyl)piperidin-4-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 139466768 |
| Molecular Formula | C26H28ClN3O3 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-[(3R,4R)-1,3-bis(4-methoxyphenyl)piperidin-4-yl]-3-(4-chlorophenyl)urea |
| SMILES | COc1ccc([C@@H]2CN(c3ccc(OC)cc3)CC[C@H]2NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H28ClN3O3/c1-32-22-11-3-18(4-12-22)24-17-30(21-9-13-23(33-2)14-10-21)16-15-25(24)29-26(31)28-20-7-5-19(27)6-8-20/h3-14,24-25H,15-17H2,1-2H3,(H2,28,29,31)/t24-,25+/m0/s1 |
| InChIKey | WDDSXVBIVQUGHG-LOSJGSFVSA-N |
| XLogP | 5.54 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|