C23H24ClN5O2 — CID 150128851
1-(6-chloro-3-pyridinyl)-3-[3-(4-methoxyphenyl)-1-pyridin-4-ylpiperidin-4-yl]urea (PubChem CID 150128851) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-3-[3-(4-methoxyphenyl)-1-pyridin-4-ylpiperidin-4-yl]urea.
| Compound Name | 1-(6-chloro-3-pyridinyl)-3-[3-(4-methoxyphenyl)-1-pyridin-4-ylpiperidin-4-yl]urea |
|---|---|
| PubChem CID | 150128851 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-3-[3-(4-methoxyphenyl)-1-pyridin-4-ylpiperidin-4-yl]urea |
| SMILES | COc1ccc(C2CN(c3ccncc3)CCC2NC(=O)Nc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C23H24ClN5O2/c1-31-19-5-2-16(3-6-19)20-15-29(18-8-11-25-12-9-18)13-10-21(20)28-23(30)27-17-4-7-22(24)26-14-17/h2-9,11-12,14,20-21H,10,13,15H2,1H3,(H2,27,28,30) |
| InChIKey | FAUPZBGNMMPCNL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|