C27H49N5O4Si2 — CID 67494768
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidine-1-carboxylate (PubChem CID 67494768) has the molecular formula C27H49N5O4Si2 and a molecular weight of 563.89 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67494768 |
| Molecular Formula | C27H49N5O4Si2 |
| Molecular Weight | 563.89 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3nccc3n2)C1 |
| InChI | InChI=1S/C27H49N5O4Si2/c1-27(2,3)36-26(33)30-13-11-22(19-30)23-18-25(32-24(29-23)10-12-28-32)31(20-34-14-16-37(4,5)6)21-35-15-17-38(7,8)9/h10,12,18,22H,11,13-17,19-21H2,1-9H3 |
| InChIKey | GNVYSNNINHVGNC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.89 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|