C29H51IN4O4Si2 — CID 67494526
tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate (PubChem CID 67494526) has the molecular formula C29H51IN4O4Si2 and a molecular weight of 702.83 g/mol. Its IUPAC name is tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67494526 |
| Molecular Formula | C29H51IN4O4Si2 |
| Molecular Weight | 702.83 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(I)c3n2)CC1 |
| InChI | InChI=1S/C29H51IN4O4Si2/c1-29(2,3)38-28(35)23-12-10-22(11-13-23)25-18-26(34-27(32-25)24(30)19-31-34)33(20-36-14-16-39(4,5)6)21-37-15-17-40(7,8)9/h18-19,22-23H,10-17,20-21H2,1-9H3 |
| InChIKey | ZMBDRRGCTIQXIZ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.83 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|