C26H39IN4O4Si2 — CID 66735691
methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]benzoate (PubChem CID 66735691) has the molecular formula C26H39IN4O4Si2 and a molecular weight of 654.70 g/mol. Its IUPAC name is methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]benzoate.
| Compound Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]benzoate |
|---|---|
| PubChem CID | 66735691 |
| Molecular Formula | C26H39IN4O4Si2 |
| Molecular Weight | 654.70 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(I)c3n2)cc1 |
| InChI | InChI=1S/C26H39IN4O4Si2/c1-33-26(32)21-10-8-20(9-11-21)23-16-24(31-25(29-23)22(27)17-28-31)30(18-34-12-14-36(2,3)4)19-35-13-15-37(5,6)7/h8-11,16-17H,12-15,18-19H2,1-7H3 |
| InChIKey | SMYMYKWDCJRYKH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|