C36H56N6O5Si2 — CID 90228218
tert-butyl (5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-formyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 90228218) has the molecular formula C36H56N6O5Si2 and a molecular weight of 709.05 g/mol. Its IUPAC name is tert-butyl (5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-formyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-formyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 90228218 |
| Molecular Formula | C36H56N6O5Si2 |
| Molecular Weight | 709.05 g/mol |
| Exact Mass | 708.39 |
| IUPAC Name | tert-butyl (5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-formyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC[C@@H]1CC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(C=O)nc4)c3n1)C2 |
| InChI | InChI=1S/C36H56N6O5Si2/c1-36(2,3)47-35(44)41-29-12-13-30(41)19-27(18-29)32-20-33(40(24-45-14-16-48(4,5)6)25-46-15-17-49(7,8)9)42-34(39-32)31(22-38-42)26-10-11-28(23-43)37-21-26/h10-11,20-23,27,29-30H,12-19,24-25H2,1-9H3/t27?,29-,30?/m1/s1 |
| InChIKey | SRSXGQAHNKHASG-PEKFUONFSA-N |
| XLogP | 7.68 |
| TPSA | 111.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.05 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|