C38H58N6O5Si2 — CID 67294863
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-hydroxyprop-1-ynyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 67294863) has the molecular formula C38H58N6O5Si2 and a molecular weight of 735.09 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-hydroxyprop-1-ynyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-hydroxyprop-1-ynyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 67294863 |
| Molecular Formula | C38H58N6O5Si2 |
| Molecular Weight | 735.09 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-hydroxyprop-1-ynyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(C#CCO)nc4)c3n1)C2 |
| InChI | InChI=1S/C38H58N6O5Si2/c1-38(2,3)49-37(46)43-31-14-15-32(43)22-29(21-31)34-23-35(42(26-47-17-19-50(4,5)6)27-48-18-20-51(7,8)9)44-36(41-34)33(25-40-44)28-12-13-30(39-24-28)11-10-16-45/h12-13,23-25,29,31-32,45H,14-22,26-27H2,1-9H3 |
| InChIKey | DVRYDMWJIYSHEF-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.09 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|