C33H52N6O3Si2 — CID 71128197
5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methylpyridine-2-carboxamide (PubChem CID 71128197) has the molecular formula C33H52N6O3Si2 and a molecular weight of 636.99 g/mol. Its IUPAC name is 5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 71128197 |
| Molecular Formula | C33H52N6O3Si2 |
| Molecular Weight | 636.99 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | 5-[5-[(1S,5R)-3-bicyclo[3.2.1]octanyl]-7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(C4C[C@H]5CC[C@@H](C4)C5)nc23)cn1 |
| InChI | InChI=1S/C33H52N6O3Si2/c1-34-33(40)29-11-10-26(20-35-29)28-21-36-39-31(19-30(37-32(28)39)27-17-24-8-9-25(16-24)18-27)38(22-41-12-14-43(2,3)4)23-42-13-15-44(5,6)7/h10-11,19-21,24-25,27H,8-9,12-18,22-23H2,1-7H3,(H,34,40)/t24-,25+,27? |
| InChIKey | NPDGAEJVNKYCDZ-YHQISMHQSA-N |
| XLogP | 6.88 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.99 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|