C33H52ClN5O6Si2 — CID 90464492
ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]-2-hydroxyacetate (PubChem CID 90464492) has the molecular formula C33H52ClN5O6Si2 and a molecular weight of 706.43 g/mol. Its IUPAC name is ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 90464492 |
| Molecular Formula | C33H52ClN5O6Si2 |
| Molecular Weight | 706.43 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | ethyl 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-hydroxycyclohexyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)C1(O)CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(Cl)nc4)c3n2)CC1 |
| InChI | InChI=1S/C33H52ClN5O6Si2/c1-8-45-32(41)30(40)33(42)13-11-24(12-14-33)27-19-29(39-31(37-27)26(21-36-39)25-9-10-28(34)35-20-25)38(22-43-15-17-46(2,3)4)23-44-16-18-47(5,6)7/h9-10,19-21,24,30,40,42H,8,11-18,22-23H2,1-7H3 |
| InChIKey | DYVFVOFTJMMUMW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|