C36H51N5O3Si2 — CID 86686669
5-(1-oxaspiro[2.5]octan-6-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 86686669) has the molecular formula C36H51N5O3Si2 and a molecular weight of 658.01 g/mol. Its IUPAC name is 5-(1-oxaspiro[2.5]octan-6-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(1-oxaspiro[2.5]octan-6-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 86686669 |
| Molecular Formula | C36H51N5O3Si2 |
| Molecular Weight | 658.01 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | 5-(1-oxaspiro[2.5]octan-6-yl)-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC3(CC2)CO3)nc2c(-c3ccc(-c4ccccc4)nc3)cnn12 |
| InChI | InChI=1S/C36H51N5O3Si2/c1-45(2,3)20-18-42-26-40(27-43-19-21-46(4,5)6)34-22-33(29-14-16-36(17-15-29)25-44-36)39-35-31(24-38-41(34)35)30-12-13-32(37-23-30)28-10-8-7-9-11-28/h7-13,22-24,29H,14-21,25-27H2,1-6H3 |
| InChIKey | LCKFNVBWUFRQJE-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.01 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|